ChemNet > CAS > 18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
Naam product |
2-Acetyl-3-methylbenzo[b]thiophene |
Engelse naam |
2-Acetyl-3-methylbenzo[b]thiophene; 2-Acetyl-3-methylthianaphthene; 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one; 1-(3-methyl-1-benzothiophen-6-yl)ethanone; 1-(3-methyl-1-benzothiophen-2-yl)ethanone |
MF |
C11H10OS |
Molecuulgewicht |
190.2615 |
InChI |
InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
CAS-nummer |
18781-31-2 |
Moleculaire Structuur |
|
Dichtheid |
1.182g/cm3 |
Smeltpunt |
79℃ |
Kookpunt |
319.5°C at 760 mmHg |
Brekingsindex |
1.631 |
Vlampunt |
147°C |
Dampdruk |
0.000337mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|